Products 1155104-43-0
CAS 1155104-43-0 is the registry number for 4-Chloro-2-(1-(propan-2-yl)-1H-pyrrole-2-amido)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-2-[(1-propan-2-ylpyrrole-2-carbonyl)amino]benzoic acid (CAS 1155104-43-0) is a chemical compound with the molecular formula C15H15ClN2O3 and a molecular weight of 306.74 g/mol. IUPAC name: 4-chloro-2-[(1-propan-2-ylpyrrole-2-carbonyl)amino]benzoic acid. InChIKey: UXQIZHLVVGMBSL-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O3 |
|---|---|
| Molecular weight | 306.74 g/mol |
| IUPAC name | 4-chloro-2-[(1-propan-2-ylpyrrole-2-carbonyl)amino]benzoic acid |
| InChIKey | UXQIZHLVVGMBSL-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=CC=C1C(=O)NC2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)