CAS 1356353-33-7 appears in our catalog under these names: Methyl 6-chloro-2-((4-methoxybenzyl)amino)nicotinate, 95%, Methyl 6–chloro–2–((4–methoxybenzyl)amino)nicotinate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 6-chloro-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylate (CAS 1356353-33-7) is a chemical compound with the molecular formula C15H15ClN2O3 and a molecular weight of 306.74 g/mol. IUPAC name: methyl 6-chloro-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylate. InChIKey: HSDAMCLWORVRJO-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O3 |
|---|---|
| Molecular weight | 306.74 g/mol |
| IUPAC name | methyl 6-chloro-2-[(4-methoxyphenyl)methylamino]pyridine-3-carboxylate |
| InChIKey | HSDAMCLWORVRJO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C(C=CC(=N2)Cl)C(=O)OC |
Computed by PubChem (NCBI)