CAS 1858257-22-3 is the registry number for 3-[4-(4-Chlorophenyl)piperazin-1-yl]-4-methoxycyclobut-3-ene-1,2-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[4-(4-chlorophenyl)piperazin-1-yl]-4-methoxycyclobut-3-ene-1,2-dione (CAS 1858257-22-3) is a chemical compound with the molecular formula C15H15ClN2O3 and a molecular weight of 306.74 g/mol. IUPAC name: 3-[4-(4-chlorophenyl)piperazin-1-yl]-4-methoxycyclobut-3-ene-1,2-dione. InChIKey: QWQVVKVOJIMSKF-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O3 |
|---|---|
| Molecular weight | 306.74 g/mol |
| IUPAC name | 3-[4-(4-chlorophenyl)piperazin-1-yl]-4-methoxycyclobut-3-ene-1,2-dione |
| InChIKey | QWQVVKVOJIMSKF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=O)C1=O)N2CCN(CC2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)