CAS 1217811-48-7 is the registry number for Methyl (3r)-2-(chloroacetyl)-2,3,4,9-tetrahydro-1h-beta-carboline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl (3R)-2-(2-chloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (CAS 1217811-48-7) is a chemical compound with the molecular formula C15H15ClN2O3 and a molecular weight of 306.74 g/mol. IUPAC name: methyl (3R)-2-(2-chloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate. InChIKey: CZYDHLJERNCTMG-CYBMUJFWSA-N.
| Molecular formula | C15H15ClN2O3 |
|---|---|
| Molecular weight | 306.74 g/mol |
| IUPAC name | methyl (3R)-2-(2-chloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| InChIKey | CZYDHLJERNCTMG-CYBMUJFWSA-N |
| SMILES | COC(=O)[C@H]1CC2=C(CN1C(=O)CCl)NC3=CC=CC=C23 |
Computed by PubChem (NCBI)