CAS 1955474-41-5 is the registry number for Methyl (3S)-2-(2-chloroacetyl)-1H,2H,3H,4H,9H-pyrido(3,4-b)indole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (3S)-2-(2-chloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (CAS 1955474-41-5) is a chemical compound with the molecular formula C15H15ClN2O3 and a molecular weight of 306.74 g/mol. IUPAC name: methyl (3S)-2-(2-chloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate. InChIKey: CZYDHLJERNCTMG-ZDUSSCGKSA-N.
| Molecular formula | C15H15ClN2O3 |
|---|---|
| Molecular weight | 306.74 g/mol |
| IUPAC name | methyl (3S)-2-(2-chloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| InChIKey | CZYDHLJERNCTMG-ZDUSSCGKSA-N |
| SMILES | COC(=O)[C@@H]1CC2=C(CN1C(=O)CCl)NC3=CC=CC=C23 |
Computed by PubChem (NCBI)