Products 1155106-03-8
CAS 1155106-03-8 is the registry number for (2,4-Dioxo-8-oxa-1,3-diaza-spiro(4.5)dec-3-yl)-acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)acetic acid (CAS 1155106-03-8) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. IUPAC name: 2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)acetic acid. InChIKey: ZFLTVDQMWUFENK-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 2-(2,4-dioxo-8-oxa-1,3-diazaspiro[4.5]decan-3-yl)acetic acid |
| InChIKey | ZFLTVDQMWUFENK-UHFFFAOYSA-N |
| SMILES | C1COCCC12C(=O)N(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)