Products 1155152-94-5
CAS 1155152-94-5 is the registry number for 4-Chloro-2,6-bis(propan-2-yl)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-2,6-di(propan-2-yl)pyrimidine (CAS 1155152-94-5) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: 4-chloro-2,6-di(propan-2-yl)pyrimidine. InChIKey: VTBIAIVKOAUJGU-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | 4-chloro-2,6-di(propan-2-yl)pyrimidine |
| InChIKey | VTBIAIVKOAUJGU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=NC(=N1)C(C)C)Cl |
Computed by PubChem (NCBI)