Products 115531-76-5
CAS 115531-76-5 is the registry number for Flaccidin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
6-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-5,13-diol (CAS 115531-76-5) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 6-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-5,13-diol. InChIKey: WOGDWPQSZQNQRT-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 6-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-5,13-diol |
| InChIKey | WOGDWPQSZQNQRT-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C3C(=C1)CCC4=C3C(=CC(=C4)O)OC2)O |
Computed by PubChem (NCBI)