CAS 1155599-28-2 appears in our catalog under these names: 2-Ethyl-6-phenoxy-1,4-dihydroquinolin-4-one, 2-Ethyl-6-phenoxy-1,4-dihydroquinolin-4-one, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
2-ethyl-6-phenoxy-1H-quinolin-4-one (CAS 1155599-28-2) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: 2-ethyl-6-phenoxy-1H-quinolin-4-one. InChIKey: RZUFSGUAPSYNDO-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 2-ethyl-6-phenoxy-1H-quinolin-4-one |
| InChIKey | RZUFSGUAPSYNDO-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)C2=C(N1)C=CC(=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)