Products 1155902-84-3
CAS 1155902-84-3 is the registry number for 2-Chloro-4-(3-chloropropanamido)benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-4-(3-chloropropanoylamino)benzamide (CAS 1155902-84-3) is a chemical compound with the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.10 g/mol. IUPAC name: 2-chloro-4-(3-chloropropanoylamino)benzamide. InChIKey: ARGCHKWPVYCIIW-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 2-chloro-4-(3-chloropropanoylamino)benzamide |
| InChIKey | ARGCHKWPVYCIIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CCCl)Cl)C(=O)N |
Computed by PubChem (NCBI)