CAS 1155911-88-8 is the registry number for (10-([1,1'-Biphenyl]-3-yl)anthracen-9-yl)boronic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[10-(3-phenylphenyl)anthracen-9-yl]boronic acid (CAS 1155911-88-8) is a chemical compound with the molecular formula C26H19BO2 and a molecular weight of 374.2 g/mol. IUPAC name: [10-(3-phenylphenyl)anthracen-9-yl]boronic acid. InChIKey: UKDBUZJPKSZSTR-UHFFFAOYSA-N.
| Molecular formula | C26H19BO2 |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | [10-(3-phenylphenyl)anthracen-9-yl]boronic acid |
| InChIKey | UKDBUZJPKSZSTR-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=CC2=C(C3=CC=CC=C13)C4=CC=CC(=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)