Products 1155911-88-8

CAS 1155911-88-8 is the registry number for (10-([1,1'-Biphenyl]-3-yl)anthracen-9-yl)boronic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

[10-(3-phenylphenyl)anthracen-9-yl]boronic acid (CAS 1155911-88-8) is a chemical compound with the molecular formula C26H19BO2 and a molecular weight of 374.2 g/mol. IUPAC name: [10-(3-phenylphenyl)anthracen-9-yl]boronic acid. InChIKey: UKDBUZJPKSZSTR-UHFFFAOYSA-N.

Identity
Molecular formulaC26H19BO2
Molecular weight374.2 g/mol
IUPAC name[10-(3-phenylphenyl)anthracen-9-yl]boronic acid
InChIKeyUKDBUZJPKSZSTR-UHFFFAOYSA-N
SMILESB(C1=C2C=CC=CC2=C(C3=CC=CC=C13)C4=CC=CC(=C4)C5=CC=CC=C5)(O)O

Computed by PubChem (NCBI)