CAS 1207886-58-5 is the registry number for (4,5-Diphenylanthracen-9-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4,5-diphenylanthracen-9-yl)boronic acid (CAS 1207886-58-5) is a chemical compound with the molecular formula C26H19BO2 and a molecular weight of 374.2 g/mol. IUPAC name: (4,5-diphenylanthracen-9-yl)boronic acid. InChIKey: AZKIQGVAOQSSQO-UHFFFAOYSA-N.
| Molecular formula | C26H19BO2 |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | (4,5-diphenylanthracen-9-yl)boronic acid |
| InChIKey | AZKIQGVAOQSSQO-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=C(C2=CC3=C1C=CC=C3C4=CC=CC=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)