CAS 400607-47-8 appears in our catalog under these names: (10-([1,1'-Biphenyl]-4-yl)anthracen-9-yl)boronic acid, 97%, (10–((1,1'–Biphenyl)–4–yl)anthracen–9–yl)boronic acid, (10-([1,1'-Biphenyl]-4-yl)anthracen-9-yl)boronic acid, 98%, 98%, (10-([1,1'-Biphenyl]-4-yl)anthracen-9-yl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
[10-(4-phenylphenyl)anthracen-9-yl]boronic acid (CAS 400607-47-8) is a chemical compound with the molecular formula C26H19BO2 and a molecular weight of 374.2 g/mol. IUPAC name: [10-(4-phenylphenyl)anthracen-9-yl]boronic acid. InChIKey: QIOZCMIWAVEQPN-UHFFFAOYSA-N.
| Molecular formula | C26H19BO2 |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | [10-(4-phenylphenyl)anthracen-9-yl]boronic acid |
| InChIKey | QIOZCMIWAVEQPN-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=CC2=C(C3=CC=CC=C13)C4=CC=C(C=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)