Products 597553-98-5
CAS 597553-98-5 appears in our catalog under these names: B-(9,10-Diphenyl-2-anthracenyl)boronic acid, 95%, 9,10-Diphenylanthracene-2-boronic Acid, 95-<97%, 9,10–Diphenylanthracene–2–boronic Acid, 9,10-Diphenylanthracene-2-boronic Acid (contains varying amounts of Anhydride), (9,10-Diphenylanthracen-2-yl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 10g, 25g, 50g, 100g, 200g, 300g.
(9,10-diphenylanthracen-2-yl)boronic acid (CAS 597553-98-5) is a chemical compound with the molecular formula C26H19BO2 and a molecular weight of 374.2 g/mol. IUPAC name: (9,10-diphenylanthracen-2-yl)boronic acid. InChIKey: MVUDLJXJTYSUGF-UHFFFAOYSA-N.
| Molecular formula | C26H19BO2 |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | (9,10-diphenylanthracen-2-yl)boronic acid |
| InChIKey | MVUDLJXJTYSUGF-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C4=CC=CC=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)
Synonyms:
9,10-diphenylanthracene-2-boronic acid, (9,10-Diphenylanthracen-2-yl)boronic acid, (9,10-Diphenylanthracen-2-yl)boronicacid, 9,10-Diphenylanthracene-2-boronic acid (contains varying amounts of Anhydride), (9,10-diphenyl-2-anthryl)boronic acid, MVUDLJXJTYSUGF-UHFFFAOYSA-N, 9,10-Diphenylanthracene-2-boronic Acid(contains varying amounts of Anhydride)