CAS 1155979-78-4 appears in our catalog under these names: N–{(3–(trifluoromethyl)phenyl)methyl}prop–2–enamide, N-{(3-(Trifluoromethyl)phenyl)methyl}prop-2-enamide, N-([3-(TRIFLUOROMETHYL)PHENYL]METHYL)PROP-2-ENAMIDE, 95%, 95%, N-([3-(TRIFLUOROMETHYL)PHENYL]METHYL)PROP-2-ENAMIDE, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g.
N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide (CAS 1155979-78-4) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide. InChIKey: GNPRFMAXHDFXQH-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| InChIKey | GNPRFMAXHDFXQH-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NCC1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)