Products 1156375-11-9
CAS 1156375-11-9 is the registry number for 3-(2-(Dimethyl-1,2-oxazol-4-yl)acetamido)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]amino]benzoic acid (CAS 1156375-11-9) is a chemical compound with the molecular formula C14H14N2O4 and a molecular weight of 274.27 g/mol. IUPAC name: 3-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]amino]benzoic acid. InChIKey: NDFZGCIOOWTEPQ-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | 3-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]amino]benzoic acid |
| InChIKey | NDFZGCIOOWTEPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CC(=O)NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)