CAS 85778-01-4 appears in our catalog under these names: 6-Chloro-5-methoxyindoline-2,3-dione 97%, 6-Chloro-5-methoxyindoline-2,3-dione, 97%, 97%, 6-chloro-5-methoxy-2,3-dihydro-1H-indole-2,3-dione, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-chloro-5-methoxy-1H-indole-2,3-dione (CAS 85778-01-4) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 6-chloro-5-methoxy-1H-indole-2,3-dione. InChIKey: FWJAXCYHPKHRKH-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 6-chloro-5-methoxy-1H-indole-2,3-dione |
| InChIKey | FWJAXCYHPKHRKH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=O)N2)Cl |
Computed by PubChem (NCBI)