CAS 54962-86-6 appears in our catalog under these names: 3,4-Dichloro-n-(propan-2-yl)aniline, 95%, 3,4-Dichloro-N-(propan-2-yl)aniline, 3,4-Dichloro-N-isopropylaniline 97%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3,4-dichloro-N-propan-2-ylaniline (CAS 54962-86-6) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 3,4-dichloro-N-propan-2-ylaniline. InChIKey: APRDBMFEPXNCSK-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 3,4-dichloro-N-propan-2-ylaniline |
| InChIKey | APRDBMFEPXNCSK-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)