Products 1156547-55-5

CAS 1156547-55-5 is the registry number for Lifitegrast Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-benzofuran-6-carbonyl chloride (CAS 1156547-55-5) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 1-benzofuran-6-carbonyl chloride. InChIKey: WKKRNEZSTQGXHO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClO2
Molecular weight180.59 g/mol
IUPAC name1-benzofuran-6-carbonyl chloride
InChIKeyWKKRNEZSTQGXHO-UHFFFAOYSA-N
SMILESC1=CC(=CC2=C1C=CO2)C(=O)Cl

Computed by PubChem (NCBI)