Products 115662-11-8
CAS 115662-11-8 appears in our catalog under these names: Coumarin VIS-443 TM-BQZ Carbonitrile, Absorption maximum (MeOH) = 443 nm, 1 g, Coumarin VIS-443 TM-BQZ Carbonitrile, Absorption maximum (MeOH) = 443 nm, 5 g, Coumarin VIS-443 TM-BQZ Carbonitrile, Absorption maximum (MeOH) = 443 nm, 10 g. Offered by: Roth. Available pack sizes: 1g, 5g, 10g.
10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonitrile (CAS 115662-11-8) is a chemical compound with the molecular formula C20H22N2O2 and a molecular weight of 322.4 g/mol. IUPAC name: 10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonitrile. InChIKey: IHSTUENJAUHYKZ-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carbonitrile |
| InChIKey | IHSTUENJAUHYKZ-UHFFFAOYSA-N |
| SMILES | CC1(CCN2CCC(C3=C4C(=CC1=C32)C=C(C(=O)O4)C#N)(C)C)C |
Computed by PubChem (NCBI)