CAS 84-31-1 appears in our catalog under these names: Quininone, (8α)-6′-Methoxycinchonan-9-one, ≥97%, ≥97%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 100mg, 2,5g, 250mg, 25mg.
[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanone (CAS 84-31-1) is a chemical compound with the molecular formula C20H22N2O2 and a molecular weight of 322.4 g/mol. IUPAC name: [(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanone. InChIKey: SRFCUPVBYYAMIL-NJSLBKSFSA-N.
| Molecular formula | C20H22N2O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | [(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanone |
| InChIKey | SRFCUPVBYYAMIL-NJSLBKSFSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)C(=O)[C@@H]3C[C@@H]4CCN3C[C@@H]4C=C |
Computed by PubChem (NCBI)