CAS 27773-65-5 appears in our catalog under these names: Vinpocetine Carboxylic Acid (Apovincaminic Acid), Vinpocetine Impurity 15, Apovincaminic acid, Vinpocetine Carboxylic Acid-d4 (Apovincaminic Acid-d4). Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg.
(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene-17-carboxylic acid (CAS 27773-65-5) is a chemical compound with the molecular formula C20H22N2O2 and a molecular weight of 322.4 g/mol. IUPAC name: (15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene-17-carboxylic acid. InChIKey: ZFCQLDAGNBFMJQ-QUCCMNQESA-N.
| Molecular formula | C20H22N2O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene-17-carboxylic acid |
| InChIKey | ZFCQLDAGNBFMJQ-QUCCMNQESA-N |
| SMILES | CC[C@@]12CCCN3[C@@H]1C4=C(CC3)C5=CC=CC=C5N4C(=C2)C(=O)O |
Computed by PubChem (NCBI)