Products 428831-12-3
CAS 428831-12-3 is the registry number for N-(3-(5,6-dimethyl-2-benzoxazolyl)-2-methylphenyl)-2-methylpropanamide. Offered by: TRC. Available pack sizes: 250mg.
N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-2-methylpropanamide (CAS 428831-12-3) is a chemical compound with the molecular formula C20H22N2O2 and a molecular weight of 322.4 g/mol. IUPAC name: N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-2-methylpropanamide. InChIKey: PLPSSFJLEBZKFN-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | N-[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-2-methylpropanamide |
| InChIKey | PLPSSFJLEBZKFN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)OC(=N2)C3=C(C(=CC=C3)NC(=O)C(C)C)C |
Computed by PubChem (NCBI)