CAS 137863-89-9 appears in our catalog under these names: Valsartan Impurity 8, Valsartan Impurity 74. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate (CAS 137863-89-9) is a chemical compound with the molecular formula C20H22N2O2 and a molecular weight of 322.4 g/mol. IUPAC name: methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate. InChIKey: ZQHINOUCNQKQEV-IBGZPJMESA-N.
| Molecular formula | C20H22N2O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | methyl (2S)-2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-methylbutanoate |
| InChIKey | ZQHINOUCNQKQEV-IBGZPJMESA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NCC1=CC=C(C=C1)C2=CC=CC=C2C#N |
Computed by PubChem (NCBI)