CAS 70336-49-1 appears in our catalog under these names: 1,4-Bis(2,6-dimethylphenyl)piperazine-2,5-dione, 97%, Lidocaine Impurity 2, Lidocaine Impurity 20. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1,4-bis(2,6-dimethylphenyl)piperazine-2,5-dione (CAS 70336-49-1) is a chemical compound with the molecular formula C20H22N2O2 and a molecular weight of 322.4 g/mol. IUPAC name: 1,4-bis(2,6-dimethylphenyl)piperazine-2,5-dione. InChIKey: ZROCEAUEVPUJAN-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 1,4-bis(2,6-dimethylphenyl)piperazine-2,5-dione |
| InChIKey | ZROCEAUEVPUJAN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N2CC(=O)N(CC2=O)C3=C(C=CC=C3C)C |
Computed by PubChem (NCBI)