Products 1156945-18-4
CAS 1156945-18-4 is the registry number for 2-(1-Chloroethyl)-5-(3,4-dimethylphenyl)-1,3,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1-chloroethyl)-5-(3,4-dimethylphenyl)-1,3,4-oxadiazole (CAS 1156945-18-4) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: 2-(1-chloroethyl)-5-(3,4-dimethylphenyl)-1,3,4-oxadiazole. InChIKey: RMAPOTKJMHDVEC-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | 2-(1-chloroethyl)-5-(3,4-dimethylphenyl)-1,3,4-oxadiazole |
| InChIKey | RMAPOTKJMHDVEC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN=C(O2)C(C)Cl)C |
Computed by PubChem (NCBI)