Products 1157138-03-8

CAS 1157138-03-8 is the registry number for 2-(3-Bromo-4-fluorophenyl)cyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3-bromo-4-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 1157138-03-8) is a chemical compound with the molecular formula C10H8BrFO2 and a molecular weight of 259.07 g/mol. IUPAC name: 2-(3-bromo-4-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: WBFLKJLMRHJNSI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrFO2
Molecular weight259.07 g/mol
IUPAC name2-(3-bromo-4-fluorophenyl)cyclopropane-1-carboxylic acid
InChIKeyWBFLKJLMRHJNSI-UHFFFAOYSA-N
SMILESC1C(C1C(=O)O)C2=CC(=C(C=C2)F)Br

Computed by PubChem (NCBI)