CAS 1314649-82-5 appears in our catalog under these names: 1-(3-Bromo-5-fluorophenyl)cyclopropane-1-carboxylic Acid, 1-(3-Bromo-5-fluorophenyl)cyclopropane-1-carboxylic acid, 97%, 97%, 1-(3-Bromo-5-fluorophenyl)cyclopropanecarboxylic acid, 97%. Offered by: TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 750mg, 0,5g, 50mg, 100mg, 250mg, 1g.
1-(3-bromo-5-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 1314649-82-5) is a chemical compound with the molecular formula C10H8BrFO2 and a molecular weight of 259.07 g/mol. IUPAC name: 1-(3-bromo-5-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: SAGGTUFHVPMZII-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFO2 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | 1-(3-bromo-5-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | SAGGTUFHVPMZII-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC(=C2)Br)F)C(=O)O |
Computed by PubChem (NCBI)