CAS 749269-74-7 appears in our catalog under these names: 1-(4-Bromo-3-fluorophenyl)cyclopropane-1-carboxylic acid, 96%, 1-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylic acid, 1-(4-Bromo-3-fluorophenyl)cyclopropanecarboxylic acid, 96%, 96%, 1-(4-Bromo-3-fluorophenyl)cyclopropanecarboxylic acid, 95%, 1-(4-Bromo-3-fluorophenyl)cyclopropanecarboxylic acid, 96%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 0,5g, 5g, 100mg.
1-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 749269-74-7) is a chemical compound with the molecular formula C10H8BrFO2 and a molecular weight of 259.07 g/mol. IUPAC name: 1-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: WKVFGGQPVGDERD-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFO2 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | 1-(4-bromo-3-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WKVFGGQPVGDERD-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)Br)F)C(=O)O |
Computed by PubChem (NCBI)