CAS 404575-30-0 is the registry number for (2E)-3-(2-Bromo-4-fluorophenyl)-2-propenoic acid, methyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (E)-3-(2-bromo-4-fluorophenyl)prop-2-enoate (CAS 404575-30-0) is a chemical compound with the molecular formula C10H8BrFO2 and a molecular weight of 259.07 g/mol. IUPAC name: methyl (E)-3-(2-bromo-4-fluorophenyl)prop-2-enoate. InChIKey: DKCTXBLIHSYOAP-HWKANZROSA-N.
| Molecular formula | C10H8BrFO2 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | methyl (E)-3-(2-bromo-4-fluorophenyl)prop-2-enoate |
| InChIKey | DKCTXBLIHSYOAP-HWKANZROSA-N |
| SMILES | COC(=O)/C=C/C1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)