Products 1314721-86-2
CAS 1314721-86-2 appears in our catalog under these names: 1-(5-Bromo-2-fluorophenyl)cyclopropanecarboxylic acid, 95%, 1-(5-BROMO-2-FLUOROPHENYL)CYCLOPROPANECARBOXYLIC ACID, 98%, 1-(5-Bromo-2-fluorophenyl)cyclopropane-1-carboxylic acid, 98%, 1-(5-Bromo-2-fluorophenyl)cyclopropane-1-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
1-(5-bromo-2-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 1314721-86-2) is a chemical compound with the molecular formula C10H8BrFO2 and a molecular weight of 259.07 g/mol. IUPAC name: 1-(5-bromo-2-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: NMIHUGJZWAYVLZ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFO2 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | 1-(5-bromo-2-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | NMIHUGJZWAYVLZ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=CC(=C2)Br)F)C(=O)O |
Computed by PubChem (NCBI)