CAS 115749-42-3 is the registry number for 2-(Thiophen-2-yl)imidazo(1,2-a)pyrimidine. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-thiophen-2-ylimidazo[1,2-a]pyrimidine (CAS 115749-42-3) is a chemical compound with the molecular formula C10H7N3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-thiophen-2-ylimidazo[1,2-a]pyrimidine. InChIKey: JZCAAAHWCAATEC-UHFFFAOYSA-N.
| Molecular formula | C10H7N3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-thiophen-2-ylimidazo[1,2-a]pyrimidine |
| InChIKey | JZCAAAHWCAATEC-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2N=C1)C3=CC=CS3 |
Computed by PubChem (NCBI)