CAS 27107-21-7 is the registry number for [1,2,4]Triazolo[3,4-a]isoquinoline-3-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2H-[1,2,4]triazolo[3,4-a]isoquinoline-3-thione (CAS 27107-21-7) is a chemical compound with the molecular formula C10H7N3S and a molecular weight of 201.25 g/mol. IUPAC name: 2H-[1,2,4]triazolo[3,4-a]isoquinoline-3-thione. InChIKey: LNKYYXCFTQLDLJ-UHFFFAOYSA-N.
| Molecular formula | C10H7N3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2H-[1,2,4]triazolo[3,4-a]isoquinoline-3-thione |
| InChIKey | LNKYYXCFTQLDLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN3C2=NNC3=S |
Computed by PubChem (NCBI)