CAS 88009-93-2 is the registry number for 5-Amino-3-phenylisothiazole-4-carbonitrile, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
5-amino-3-phenyl-1,2-thiazole-4-carbonitrile (CAS 88009-93-2) is a chemical compound with the molecular formula C10H7N3S and a molecular weight of 201.25 g/mol. IUPAC name: 5-amino-3-phenyl-1,2-thiazole-4-carbonitrile. InChIKey: VIZFEBZHODCCHQ-UHFFFAOYSA-N.
| Molecular formula | C10H7N3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 5-amino-3-phenyl-1,2-thiazole-4-carbonitrile |
| InChIKey | VIZFEBZHODCCHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=C2C#N)N |
Computed by PubChem (NCBI)