CAS 352018-96-3 appears in our catalog under these names: 4-(1H-Pyrazol-1-yl)phenyl isothiocyanate, 95%, 4-(1H-Pyrazol-1-yl)phenyl isothiocyanate, 95% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 250mg, 1g.
1-(4-isothiocyanatophenyl)pyrazole (CAS 352018-96-3) is a chemical compound with the molecular formula C10H7N3S and a molecular weight of 201.25 g/mol. IUPAC name: 1-(4-isothiocyanatophenyl)pyrazole. InChIKey: GLAOJNMWLIFKCG-UHFFFAOYSA-N.
| Molecular formula | C10H7N3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 1-(4-isothiocyanatophenyl)pyrazole |
| InChIKey | GLAOJNMWLIFKCG-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)