Products 1247879-14-6
CAS 1247879-14-6 is the registry number for 6,7-Dihydro-5H-thiazolo[4,5-f]indole-2-carbonitrile, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dihydro-5H-pyrrolo[3,2-f][1,3]benzothiazole-2-carbonitrile (CAS 1247879-14-6) is a chemical compound with the molecular formula C10H7N3S and a molecular weight of 201.25 g/mol. IUPAC name: 6,7-dihydro-5H-pyrrolo[3,2-f][1,3]benzothiazole-2-carbonitrile. InChIKey: ZQZBERNAUFKASR-UHFFFAOYSA-N.
| Molecular formula | C10H7N3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 6,7-dihydro-5H-pyrrolo[3,2-f][1,3]benzothiazole-2-carbonitrile |
| InChIKey | ZQZBERNAUFKASR-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC3=C(C=C21)N=C(S3)C#N |
Computed by PubChem (NCBI)