CAS 1158272-89-9 is the registry number for Ethyl n-(2-cyano-4-nitrophenyl)glycinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2-(2-cyano-4-nitroanilino)acetate (CAS 1158272-89-9) is a chemical compound with the molecular formula C11H11N3O4 and a molecular weight of 249.22 g/mol. IUPAC name: ethyl 2-(2-cyano-4-nitroanilino)acetate. InChIKey: WKOJEFDHGOMHKS-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O4 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | ethyl 2-(2-cyano-4-nitroanilino)acetate |
| InChIKey | WKOJEFDHGOMHKS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC1=C(C=C(C=C1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)