Products 315671-51-3

CAS 315671-51-3 is the registry number for 4-Oxo-4-(2-(phenylcarbamoyl)hydrazinyl)but-2-enoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(E)-4-oxo-4-[2-(phenylcarbamoyl)hydrazinyl]but-2-enoic acid (CAS 315671-51-3) is a chemical compound with the molecular formula C11H11N3O4 and a molecular weight of 249.22 g/mol. IUPAC name: (E)-4-oxo-4-[2-(phenylcarbamoyl)hydrazinyl]but-2-enoic acid. InChIKey: AQDYTJXWBDIXIH-VOTSOKGWSA-N.

Identity
Molecular formulaC11H11N3O4
Molecular weight249.22 g/mol
IUPAC name(E)-4-oxo-4-[2-(phenylcarbamoyl)hydrazinyl]but-2-enoic acid
InChIKeyAQDYTJXWBDIXIH-VOTSOKGWSA-N
SMILESC1=CC=C(C=C1)NC(=O)NNC(=O)/C=C/C(=O)O

Computed by PubChem (NCBI)