CAS 6525-46-8 appears in our catalog under these names: 2-Amino-3-(5-nitro-1h-indol-3-yl)propanoic acid, 95%, 5-Nitro-DL-tryptophan, 2-Amino-3-(5-nitro-1H-indol-3-yl)propanoic acid, 95%, 95%, 5-Nitrotryptophan, 5-Nitro-DL-tryptophan, min. 95 %, 1 g. Offered by: Combi-blocks, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 500mg, 50mg, 2g, 5g, 10g.
2-amino-3-(5-nitro-1H-indol-3-yl)propanoic acid (CAS 6525-46-8) is a chemical compound with the molecular formula C11H11N3O4 and a molecular weight of 249.22 g/mol. IUPAC name: 2-amino-3-(5-nitro-1H-indol-3-yl)propanoic acid. InChIKey: XKDUODGOACYEEU-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O4 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 2-amino-3-(5-nitro-1H-indol-3-yl)propanoic acid |
| InChIKey | XKDUODGOACYEEU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)