CAS 59128-07-3 is the registry number for Ethyl 2-(6-nitroimidazo[1,2-a]pyridin-2-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 2-(6-nitroimidazo[1,2-a]pyridin-2-yl)acetate (CAS 59128-07-3) is a chemical compound with the molecular formula C11H11N3O4 and a molecular weight of 249.22 g/mol. IUPAC name: ethyl 2-(6-nitroimidazo[1,2-a]pyridin-2-yl)acetate. InChIKey: NORAQSGGRFQACW-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O4 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | ethyl 2-(6-nitroimidazo[1,2-a]pyridin-2-yl)acetate |
| InChIKey | NORAQSGGRFQACW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CN2C=C(C=CC2=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)