CAS 2633725-86-5 is the registry number for 5-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-6-methylnicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4-dioxo-1,3-diazinan-1-yl)-6-methylpyridine-3-carboxylic acid (CAS 2633725-86-5) is a chemical compound with the molecular formula C11H11N3O4 and a molecular weight of 249.22 g/mol. IUPAC name: 5-(2,4-dioxo-1,3-diazinan-1-yl)-6-methylpyridine-3-carboxylic acid. InChIKey: OCYPBBNORMRNEC-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O4 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 5-(2,4-dioxo-1,3-diazinan-1-yl)-6-methylpyridine-3-carboxylic acid |
| InChIKey | OCYPBBNORMRNEC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)C(=O)O)N2CCC(=O)NC2=O |
Computed by PubChem (NCBI)