Products 1158353-54-8
CAS 1158353-54-8 is the registry number for [4-(1H-Pyrazol-1-yl)benzyl]amine sulfate (2:1), 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
(4-pyrazol-1-ylphenyl)methanamine;sulfuric acid (CAS 1158353-54-8) is a chemical compound with the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. IUPAC name: (4-pyrazol-1-ylphenyl)methanamine;sulfuric acid. InChIKey: KMNIMFADPKPNJF-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O4S |
|---|---|
| Molecular weight | 271.30 g/mol |
| IUPAC name | (4-pyrazol-1-ylphenyl)methanamine;sulfuric acid |
| InChIKey | KMNIMFADPKPNJF-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC=C(C=C2)CN.OS(=O)(=O)O |
Computed by PubChem (NCBI)