CAS 158704-07-5 is the registry number for o-Acetyllamivudine, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
[(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl acetate (CAS 158704-07-5) is a chemical compound with the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. IUPAC name: [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl acetate. InChIKey: GOKJDGDJMGPXQO-DTWKUNHWSA-N.
| Molecular formula | C10H13N3O4S |
|---|---|
| Molecular weight | 271.30 g/mol |
| IUPAC name | [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl acetate |
| InChIKey | GOKJDGDJMGPXQO-DTWKUNHWSA-N |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](CS1)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)