CAS 158704-08-6 is the registry number for N-Acetyllamivudine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
N-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide (CAS 158704-08-6) is a chemical compound with the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. IUPAC name: N-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide. InChIKey: NKMKJZRNUUXFOB-DTWKUNHWSA-N.
| Molecular formula | C10H13N3O4S |
|---|---|
| Molecular weight | 271.30 g/mol |
| IUPAC name | N-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide |
| InChIKey | NKMKJZRNUUXFOB-DTWKUNHWSA-N |
| SMILES | CC(=O)NC1=NC(=O)N(C=C1)[C@@H]2CS[C@@H](O2)CO |
Computed by PubChem (NCBI)