CAS 301331-16-8 appears in our catalog under these names: 1-((2-Nitrophenyl)sulfonyl)piperazine, 98%, 1-((2-Nitrophenyl)sulfonyl)piperazine. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 10g.
1-(2-nitrophenyl)sulfonylpiperazine (CAS 301331-16-8) is a chemical compound with the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. IUPAC name: 1-(2-nitrophenyl)sulfonylpiperazine. InChIKey: DBCUQKKNQBCTBB-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O4S |
|---|---|
| Molecular weight | 271.30 g/mol |
| IUPAC name | 1-(2-nitrophenyl)sulfonylpiperazine |
| InChIKey | DBCUQKKNQBCTBB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)