Products 173159-94-9
CAS 173159-94-9 appears in our catalog under these names: N,N-Dimethyl-2-aminosulfonyl-4-formamidobenzamide, >95% (HPLC), 2-(Aminosulfonyl)-4-(formylamino)-N,N-dimethylbenzamide. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 25mg, 50mg, 5mg, 10mg.
4-formamido-N,N-dimethyl-2-sulfamoylbenzamide (CAS 173159-94-9) is a chemical compound with the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. IUPAC name: 4-formamido-N,N-dimethyl-2-sulfamoylbenzamide. InChIKey: FYZIKEKHLDPREF-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O4S |
|---|---|
| Molecular weight | 271.30 g/mol |
| IUPAC name | 4-formamido-N,N-dimethyl-2-sulfamoylbenzamide |
| InChIKey | FYZIKEKHLDPREF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)NC=O)S(=O)(=O)N |
Computed by PubChem (NCBI)