Products 1158356-14-9
CAS 1158356-14-9 appears in our catalog under these names: 1-[(4-Methylphenyl)sulfonyl]piperidin-4-amine hydrochloride, 95%, 1-Tosylpiperidin-4-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(4-methylphenyl)sulfonylpiperidin-4-amine;hydrochloride (CAS 1158356-14-9) is a chemical compound with the molecular formula C12H19ClN2O2S and a molecular weight of 290.81 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpiperidin-4-amine;hydrochloride. InChIKey: KAEPPNIAQVXQDC-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O2S |
|---|---|
| Molecular weight | 290.81 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpiperidin-4-amine;hydrochloride |
| InChIKey | KAEPPNIAQVXQDC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)N.Cl |
Computed by PubChem (NCBI)