CAS 1224170-51-7 is the registry number for 2-[4-(Pyrrolidin-1-ylsulfonyl)phenyl]ethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-(4-pyrrolidin-1-ylsulfonylphenyl)ethanamine;hydrochloride (CAS 1224170-51-7) is a chemical compound with the molecular formula C12H19ClN2O2S and a molecular weight of 290.81 g/mol. IUPAC name: 2-(4-pyrrolidin-1-ylsulfonylphenyl)ethanamine;hydrochloride. InChIKey: JVVDJPBHXFTCSN-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O2S |
|---|---|
| Molecular weight | 290.81 g/mol |
| IUPAC name | 2-(4-pyrrolidin-1-ylsulfonylphenyl)ethanamine;hydrochloride |
| InChIKey | JVVDJPBHXFTCSN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=C(C=C2)CCN.Cl |
Computed by PubChem (NCBI)