Products 1803591-09-4
CAS 1803591-09-4 appears in our catalog under these names: 1-(3,4-Dimethylbenzenesulfonyl)piperazine hydrochloride, 95%, 1-(3,4-Dimethylbenzenesulfonyl)piperazine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
1-(3,4-dimethylphenyl)sulfonylpiperazine;hydrochloride (CAS 1803591-09-4) is a chemical compound with the molecular formula C12H19ClN2O2S and a molecular weight of 290.81 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)sulfonylpiperazine;hydrochloride. InChIKey: QKZBUIGZOLALHF-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O2S |
|---|---|
| Molecular weight | 290.81 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | QKZBUIGZOLALHF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N2CCNCC2)C.Cl |
Computed by PubChem (NCBI)