CAS 1603766-70-6 is the registry number for 1-(Benzylsulfonyl)-1,4-diazepane hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzylsulfonyl-1,4-diazepane;hydrochloride (CAS 1603766-70-6) is a chemical compound with the molecular formula C12H19ClN2O2S and a molecular weight of 290.81 g/mol. IUPAC name: 1-benzylsulfonyl-1,4-diazepane;hydrochloride. InChIKey: NSQUIAXCMCHINB-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O2S |
|---|---|
| Molecular weight | 290.81 g/mol |
| IUPAC name | 1-benzylsulfonyl-1,4-diazepane;hydrochloride |
| InChIKey | NSQUIAXCMCHINB-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)S(=O)(=O)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)